C23H24F4N2O3S — CID 88965296
6-[2-ethyl-4-[2-fluoro-4-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonyl-2,3-dihydro-1H-indene-1-carbaldehyde (PubChem CID 88965296) has the molecular formula C23H24F4N2O3S and a molecular weight of 484.52 g/mol. Its IUPAC name is 6-[2-ethyl-4-[2-fluoro-4-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonyl-2,3-dihydro-1H-indene-1-carbaldehyde.
| Compound Name | 6-[2-ethyl-4-[2-fluoro-4-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonyl-2,3-dihydro-1H-indene-1-carbaldehyde |
|---|---|
| PubChem CID | 88965296 |
| Molecular Formula | C23H24F4N2O3S |
| Molecular Weight | 484.52 g/mol |
| Exact Mass | 484.14 |
| IUPAC Name | 6-[2-ethyl-4-[2-fluoro-4-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonyl-2,3-dihydro-1H-indene-1-carbaldehyde |
| SMILES | CCC1CN(c2ccc(C(F)(F)F)cc2F)CCN1S(=O)(=O)c1ccc2c(c1)C(C=O)CC2 |
| InChI | InChI=1S/C23H24F4N2O3S/c1-2-18-13-28(22-8-6-17(11-21(22)24)23(25,26)27)9-10-29(18)33(31,32)19-7-5-15-3-4-16(14-30)20(15)12-19/h5-8,11-12,14,16,18H,2-4,9-10,13H2,1H3 |
| InChIKey | JZBKRCZIMNPBBF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|