About 7-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-4-oxoquinoline-3-carbaldehyde
7-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-4-oxoquinoline-3-carbaldehyde (PubChem CID 88965440) has the molecular formula C14H11F2NO3
and a molecular weight of 279.24 g/mol. Its IUPAC name is 7-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-4-oxoquinoline-3-carbaldehyde.
Molecular Properties
| Compound Name | 7-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-4-oxoquinoline-3-carbaldehyde |
| PubChem CID | 88965440 |
| Molecular Formula | C14H11F2NO3 |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 7-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-4-oxoquinoline-3-carbaldehyde |
| SMILES | COc1c(F)ccc2c(=O)c(C=O)cn([C@@H]3C[C@@H]3F)c12 |
| InChI | InChI=1S/C14H11F2NO3/c1-20-14-9(15)3-2-8-12(14)17(11-4-10(11)16)5-7(6-18)13(8)19/h2-3,5-6,10-11H,4H2,1H3/t10-,11+/m0/s1 |
| InChIKey | WTKWQPLXZMRKSO-WDEREUQCSA-N |
| XLogP | 2.24 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-4-oxoquinoline-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-4-oxoquinoline-3-carbaldehyde?
The IUPAC name of 7-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-4-oxoquinoline-3-carbaldehyde (CID 88965440) is 7-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-4-oxoquinoline-3-carbaldehyde.
What is the SMILES notation for 7-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-4-oxoquinoline-3-carbaldehyde?
The canonical SMILES for 7-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-4-oxoquinoline-3-carbaldehyde is COc1c(F)ccc2c(=O)c(C=O)cn([C@@H]3C[C@@H]3F)c12.
What is the InChIKey of 7-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-4-oxoquinoline-3-carbaldehyde?
The InChIKey is WTKWQPLXZMRKSO-WDEREUQCSA-N. The full InChI is InChI=1S/C14H11F2NO3/c1-20-14-9(15)3-2-8-12(14)17(11-4-10(11)16)5-7(6-18)13(8)19/h2-3,5-6,10-11H,4H2,1H3/t10-,11+/m0/s1.
What are the key properties of 7-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-4-oxoquinoline-3-carbaldehyde?
7-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-4-oxoquinoline-3-carbaldehyde has a molecular weight of 279.24 g/mol, XLogP of 2.24, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-8-methoxy-4-oxoquinoline-3-carbaldehyde is sourced from PubChem (CID 88965440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).