C22H29N3O4S2 — CID 88965488
3-[[2-[[cyclohexyl(2-phenylmethoxyethyl)carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]propanoic acid (PubChem CID 88965488) has the molecular formula C22H29N3O4S2 and a molecular weight of 463.63 g/mol. Its IUPAC name is 3-[[2-[[cyclohexyl(2-phenylmethoxyethyl)carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]propanoic acid.
| Compound Name | 3-[[2-[[cyclohexyl(2-phenylmethoxyethyl)carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 88965488 |
| Molecular Formula | C22H29N3O4S2 |
| Molecular Weight | 463.63 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 3-[[2-[[cyclohexyl(2-phenylmethoxyethyl)carbamoyl]amino]-1,3-thiazol-5-yl]sulfanyl]propanoic acid |
| SMILES | O=C(O)CCSc1cnc(NC(=O)N(CCOCc2ccccc2)C2CCCCC2)s1 |
| InChI | InChI=1S/C22H29N3O4S2/c26-19(27)11-14-30-20-15-23-21(31-20)24-22(28)25(18-9-5-2-6-10-18)12-13-29-16-17-7-3-1-4-8-17/h1,3-4,7-8,15,18H,2,5-6,9-14,16H2,(H,26,27)(H,23,24,28) |
| InChIKey | HSAOWLLJEVWJKN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.63 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|