C20H19ClN6O3 — CID 88965865
(E)-4-[5-(5-chloro-2-hydroxyanilino)-7-(cyclopropylamino)pyrazolo[1,5-a]pyrimidin-3-yl]-3-formylbut-3-enamide (PubChem CID 88965865) has the molecular formula C20H19ClN6O3 and a molecular weight of 426.86 g/mol. Its IUPAC name is (E)-4-[5-(5-chloro-2-hydroxyanilino)-7-(cyclopropylamino)pyrazolo[1,5-a]pyrimidin-3-yl]-3-formylbut-3-enamide.
| Compound Name | (E)-4-[5-(5-chloro-2-hydroxyanilino)-7-(cyclopropylamino)pyrazolo[1,5-a]pyrimidin-3-yl]-3-formylbut-3-enamide |
|---|---|
| PubChem CID | 88965865 |
| Molecular Formula | C20H19ClN6O3 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | (E)-4-[5-(5-chloro-2-hydroxyanilino)-7-(cyclopropylamino)pyrazolo[1,5-a]pyrimidin-3-yl]-3-formylbut-3-enamide |
| SMILES | NC(=O)C/C(C=O)=C\c1cnn2c(NC3CC3)cc(Nc3cc(Cl)ccc3O)nc12 |
| InChI | InChI=1S/C20H19ClN6O3/c21-13-1-4-16(29)15(7-13)25-18-8-19(24-14-2-3-14)27-20(26-18)12(9-23-27)5-11(10-28)6-17(22)30/h1,4-5,7-10,14,24,29H,2-3,6H2,(H2,22,30)(H,25,26)/b11-5+ |
| InChIKey | RFLRNVTYBJBWHN-VZUCSPMQSA-N |
| XLogP | 2.86 |
| TPSA | 134.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|