About 7-nitroso-2-pyrrolidin-1-ium-1-ylidene-1,3-benzodithiol-4-ol
7-nitroso-2-pyrrolidin-1-ium-1-ylidene-1,3-benzodithiol-4-ol (PubChem CID 88965949) has the molecular formula C11H11N2O2S2+
and a molecular weight of 267.35 g/mol. Its IUPAC name is 7-nitroso-2-pyrrolidin-1-ium-1-ylidene-1,3-benzodithiol-4-ol.
Molecular Properties
| Compound Name | 7-nitroso-2-pyrrolidin-1-ium-1-ylidene-1,3-benzodithiol-4-ol |
| PubChem CID | 88965949 |
| Molecular Formula | C11H11N2O2S2+ |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 7-nitroso-2-pyrrolidin-1-ium-1-ylidene-1,3-benzodithiol-4-ol |
| SMILES | O=Nc1ccc(O)c2sc(=[N+]3CCCC3)sc12 |
| InChI | InChI=1S/C11H10N2O2S2/c14-8-4-3-7(12-15)9-10(8)17-11(16-9)13-5-1-2-6-13/h3-4H,1-2,5-6H2/p+1 |
| InChIKey | DKLOVUXYKXHZLE-UHFFFAOYSA-O |
| XLogP | 2.63 |
| TPSA | 52.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 7-nitroso-2-pyrrolidin-1-ium-1-ylidene-1,3-benzodithiol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-nitroso-2-pyrrolidin-1-ium-1-ylidene-1,3-benzodithiol-4-ol?
The IUPAC name of 7-nitroso-2-pyrrolidin-1-ium-1-ylidene-1,3-benzodithiol-4-ol (CID 88965949) is 7-nitroso-2-pyrrolidin-1-ium-1-ylidene-1,3-benzodithiol-4-ol.
What is the SMILES notation for 7-nitroso-2-pyrrolidin-1-ium-1-ylidene-1,3-benzodithiol-4-ol?
The canonical SMILES for 7-nitroso-2-pyrrolidin-1-ium-1-ylidene-1,3-benzodithiol-4-ol is O=Nc1ccc(O)c2sc(=[N+]3CCCC3)sc12.
What is the InChIKey of 7-nitroso-2-pyrrolidin-1-ium-1-ylidene-1,3-benzodithiol-4-ol?
The InChIKey is DKLOVUXYKXHZLE-UHFFFAOYSA-O. The full InChI is InChI=1S/C11H10N2O2S2/c14-8-4-3-7(12-15)9-10(8)17-11(16-9)13-5-1-2-6-13/h3-4H,1-2,5-6H2/p+1.
What are the key properties of 7-nitroso-2-pyrrolidin-1-ium-1-ylidene-1,3-benzodithiol-4-ol?
7-nitroso-2-pyrrolidin-1-ium-1-ylidene-1,3-benzodithiol-4-ol has a molecular weight of 267.35 g/mol, XLogP of 2.63, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitroso-2-pyrrolidin-1-ium-1-ylidene-1,3-benzodithiol-4-ol is sourced from PubChem (CID 88965949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).