C7H11NO2 — CID 88966159
(3Z,5E)-7-aminohepta-1,3,5-triene-2,5-diol (PubChem CID 88966159) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is (3Z,5E)-7-aminohepta-1,3,5-triene-2,5-diol.
| Compound Name | (3Z,5E)-7-aminohepta-1,3,5-triene-2,5-diol |
|---|---|
| PubChem CID | 88966159 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (3Z,5E)-7-aminohepta-1,3,5-triene-2,5-diol |
| SMILES | C=C(O)/C=C\C(O)=C/CN |
| InChI | InChI=1S/C7H11NO2/c1-6(9)2-3-7(10)4-5-8/h2-4,9-10H,1,5,8H2/b3-2-,7-4+ |
| InChIKey | ATKNSWYCRMTIDS-UDJLOATDSA-N |
| XLogP | 1.01 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|