About hexa-1,5-diene-2,5-diamine
hexa-1,5-diene-2,5-diamine (PubChem CID 88966160) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is hexa-1,5-diene-2,5-diamine.
Molecular Properties
| Compound Name | hexa-1,5-diene-2,5-diamine |
| PubChem CID | 88966160 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | hexa-1,5-diene-2,5-diamine |
| SMILES | C=C(N)CCC(=C)N |
| InChI | InChI=1S/C6H12N2/c1-5(7)3-4-6(2)8/h1-4,7-8H2 |
| InChIKey | CCLWUYICSQBHCX-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze hexa-1,5-diene-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexa-1,5-diene-2,5-diamine?
The IUPAC name of hexa-1,5-diene-2,5-diamine (CID 88966160) is hexa-1,5-diene-2,5-diamine.
What is the SMILES notation for hexa-1,5-diene-2,5-diamine?
The canonical SMILES for hexa-1,5-diene-2,5-diamine is C=C(N)CCC(=C)N.
What is the InChIKey of hexa-1,5-diene-2,5-diamine?
The InChIKey is CCLWUYICSQBHCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2/c1-5(7)3-4-6(2)8/h1-4,7-8H2.
What are the key properties of hexa-1,5-diene-2,5-diamine?
hexa-1,5-diene-2,5-diamine has a molecular weight of 112.18 g/mol, XLogP of 0.71, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexa-1,5-diene-2,5-diamine is sourced from PubChem (CID 88966160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).