C16H16F3N5O3S2 — CID 88966236
4-amino-N-[2,3,6-trifluoro-5-(propylsulfonylamino)phenyl]-6,7-dihydrothieno[3,2-d]pyrimidine-7-carboxamide (PubChem CID 88966236) has the molecular formula C16H16F3N5O3S2 and a molecular weight of 447.46 g/mol. Its IUPAC name is 4-amino-N-[2,3,6-trifluoro-5-(propylsulfonylamino)phenyl]-6,7-dihydrothieno[3,2-d]pyrimidine-7-carboxamide.
| Compound Name | 4-amino-N-[2,3,6-trifluoro-5-(propylsulfonylamino)phenyl]-6,7-dihydrothieno[3,2-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 88966236 |
| Molecular Formula | C16H16F3N5O3S2 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | 4-amino-N-[2,3,6-trifluoro-5-(propylsulfonylamino)phenyl]-6,7-dihydrothieno[3,2-d]pyrimidine-7-carboxamide |
| SMILES | CCCS(=O)(=O)Nc1cc(F)c(F)c(NC(=O)C2CSc3c(N)ncnc32)c1F |
| InChI | InChI=1S/C16H16F3N5O3S2/c1-2-3-29(26,27)24-9-4-8(17)10(18)13(11(9)19)23-16(25)7-5-28-14-12(7)21-6-22-15(14)20/h4,6-7,24H,2-3,5H2,1H3,(H,23,25)(H2,20,21,22) |
| InChIKey | RYEVGDFGHDAOIX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|