C9H10BrN3 — CID 88966694
4-[(3E,5E)-5-bromohepta-1,3,5-trien-3-yl]-1,2,4-triazole (PubChem CID 88966694) has the molecular formula C9H10BrN3 and a molecular weight of 240.10 g/mol. Its IUPAC name is 4-[(3E,5E)-5-bromohepta-1,3,5-trien-3-yl]-1,2,4-triazole.
| Compound Name | 4-[(3E,5E)-5-bromohepta-1,3,5-trien-3-yl]-1,2,4-triazole |
|---|---|
| PubChem CID | 88966694 |
| Molecular Formula | C9H10BrN3 |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | 4-[(3E,5E)-5-bromohepta-1,3,5-trien-3-yl]-1,2,4-triazole |
| SMILES | C=C/C(=C\C(Br)=C/C)n1cnnc1 |
| InChI | InChI=1S/C9H10BrN3/c1-3-8(10)5-9(4-2)13-6-11-12-7-13/h3-7H,2H2,1H3/b8-3+,9-5+ |
| InChIKey | PLAASVKGNGKQQA-RWQQVSAMSA-N |
| XLogP | 2.60 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|