About (5R)-5,6,6-trimethylnonan-3-amine
(5R)-5,6,6-trimethylnonan-3-amine (PubChem CID 88967140) has the molecular formula C12H27N
and a molecular weight of 185.35 g/mol. Its IUPAC name is (5R)-5,6,6-trimethylnonan-3-amine.
Molecular Properties
| Compound Name | (5R)-5,6,6-trimethylnonan-3-amine |
| PubChem CID | 88967140 |
| Molecular Formula | C12H27N |
| Molecular Weight | 185.35 g/mol |
| Exact Mass | 185.21 |
| IUPAC Name | (5R)-5,6,6-trimethylnonan-3-amine |
| SMILES | CCCC(C)(C)[C@H](C)CC(N)CC |
| InChI | InChI=1S/C12H27N/c1-6-8-12(4,5)10(3)9-11(13)7-2/h10-11H,6-9,13H2,1-5H3/t10-,11?/m1/s1 |
| InChIKey | RITJXCJGZAEUAG-NFJWQWPMSA-N |
| XLogP | 3.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.35 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5R)-5,6,6-trimethylnonan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5,6,6-trimethylnonan-3-amine?
The IUPAC name of (5R)-5,6,6-trimethylnonan-3-amine (CID 88967140) is (5R)-5,6,6-trimethylnonan-3-amine.
What is the SMILES notation for (5R)-5,6,6-trimethylnonan-3-amine?
The canonical SMILES for (5R)-5,6,6-trimethylnonan-3-amine is CCCC(C)(C)[C@H](C)CC(N)CC.
What is the InChIKey of (5R)-5,6,6-trimethylnonan-3-amine?
The InChIKey is RITJXCJGZAEUAG-NFJWQWPMSA-N. The full InChI is InChI=1S/C12H27N/c1-6-8-12(4,5)10(3)9-11(13)7-2/h10-11H,6-9,13H2,1-5H3/t10-,11?/m1/s1.
What are the key properties of (5R)-5,6,6-trimethylnonan-3-amine?
(5R)-5,6,6-trimethylnonan-3-amine has a molecular weight of 185.35 g/mol, XLogP of 3.58, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5,6,6-trimethylnonan-3-amine is sourced from PubChem (CID 88967140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).