C20H22N8O2S — CID 88968475
N-[4-[4-[(5-cyano-1,3-thiazol-2-yl)amino]-6-(4-methylpiperazin-1-yl)pyrimidin-2-yl]oxybut-2-ynyl]prop-2-enamide (PubChem CID 88968475) has the molecular formula C20H22N8O2S and a molecular weight of 438.52 g/mol. Its IUPAC name is N-[4-[4-[(5-cyano-1,3-thiazol-2-yl)amino]-6-(4-methylpiperazin-1-yl)pyrimidin-2-yl]oxybut-2-ynyl]prop-2-enamide.
| Compound Name | N-[4-[4-[(5-cyano-1,3-thiazol-2-yl)amino]-6-(4-methylpiperazin-1-yl)pyrimidin-2-yl]oxybut-2-ynyl]prop-2-enamide |
|---|---|
| PubChem CID | 88968475 |
| Molecular Formula | C20H22N8O2S |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[4-[4-[(5-cyano-1,3-thiazol-2-yl)amino]-6-(4-methylpiperazin-1-yl)pyrimidin-2-yl]oxybut-2-ynyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC#CCOc1nc(Nc2ncc(C#N)s2)cc(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C20H22N8O2S/c1-3-18(29)22-6-4-5-11-30-19-24-16(25-20-23-14-15(13-21)31-20)12-17(26-19)28-9-7-27(2)8-10-28/h3,12,14H,1,6-11H2,2H3,(H,22,29)(H,23,24,25,26) |
| InChIKey | ULJVZUMJDVVQSK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 119.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|