About (E)-3-amino-N'-(2-aminoethyl)-2-(trifluoromethyl)prop-2-enimidamide
(E)-3-amino-N'-(2-aminoethyl)-2-(trifluoromethyl)prop-2-enimidamide (PubChem CID 88968501) has the molecular formula C6H11F3N4
and a molecular weight of 196.18 g/mol. Its IUPAC name is (E)-3-amino-N'-(2-aminoethyl)-2-(trifluoromethyl)prop-2-enimidamide.
Molecular Properties
| Compound Name | (E)-3-amino-N'-(2-aminoethyl)-2-(trifluoromethyl)prop-2-enimidamide |
| PubChem CID | 88968501 |
| Molecular Formula | C6H11F3N4 |
| Molecular Weight | 196.18 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (E)-3-amino-N'-(2-aminoethyl)-2-(trifluoromethyl)prop-2-enimidamide |
| SMILES | N/C=C(C(\N)=N\CCN)/C(F)(F)F |
| InChI | InChI=1S/C6H11F3N4/c7-6(8,9)4(3-11)5(12)13-2-1-10/h3H,1-2,10-11H2,(H2,12,13)/b4-3+ |
| InChIKey | UNXOISGGMRCTNW-ONEGZZNKSA-N |
| XLogP | -0.29 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.18 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-amino-N'-(2-aminoethyl)-2-(trifluoromethyl)prop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-amino-N'-(2-aminoethyl)-2-(trifluoromethyl)prop-2-enimidamide?
The IUPAC name of (E)-3-amino-N'-(2-aminoethyl)-2-(trifluoromethyl)prop-2-enimidamide (CID 88968501) is (E)-3-amino-N'-(2-aminoethyl)-2-(trifluoromethyl)prop-2-enimidamide.
What is the SMILES notation for (E)-3-amino-N'-(2-aminoethyl)-2-(trifluoromethyl)prop-2-enimidamide?
The canonical SMILES for (E)-3-amino-N'-(2-aminoethyl)-2-(trifluoromethyl)prop-2-enimidamide is N/C=C(C(\N)=N\CCN)/C(F)(F)F.
What is the InChIKey of (E)-3-amino-N'-(2-aminoethyl)-2-(trifluoromethyl)prop-2-enimidamide?
The InChIKey is UNXOISGGMRCTNW-ONEGZZNKSA-N. The full InChI is InChI=1S/C6H11F3N4/c7-6(8,9)4(3-11)5(12)13-2-1-10/h3H,1-2,10-11H2,(H2,12,13)/b4-3+.
What are the key properties of (E)-3-amino-N'-(2-aminoethyl)-2-(trifluoromethyl)prop-2-enimidamide?
(E)-3-amino-N'-(2-aminoethyl)-2-(trifluoromethyl)prop-2-enimidamide has a molecular weight of 196.18 g/mol, XLogP of -0.29, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-amino-N'-(2-aminoethyl)-2-(trifluoromethyl)prop-2-enimidamide is sourced from PubChem (CID 88968501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).