C13H23N3O — CID 88968557
(1E,3Z)-2-[3-(aminomethoxymethyl)-1-methylpyrrolidin-2-yl]hexa-1,3,5-trien-1-amine (PubChem CID 88968557) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is (1E,3Z)-2-[3-(aminomethoxymethyl)-1-methylpyrrolidin-2-yl]hexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z)-2-[3-(aminomethoxymethyl)-1-methylpyrrolidin-2-yl]hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 88968557 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | (1E,3Z)-2-[3-(aminomethoxymethyl)-1-methylpyrrolidin-2-yl]hexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C\C(=C/N)C1C(COCN)CCN1C |
| InChI | InChI=1S/C13H23N3O/c1-3-4-5-11(8-14)13-12(9-17-10-15)6-7-16(13)2/h3-5,8,12-13H,1,6-7,9-10,14-15H2,2H3/b5-4-,11-8+ |
| InChIKey | DIMKZURECXEPMO-LGXSBLIVSA-N |
| XLogP | 0.82 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|