C12H20N2O — CID 88968630
[2-[(1E,3Z)-1-aminohexa-1,3,5-trien-2-yl]-1-methylpyrrolidin-3-yl]methanol (PubChem CID 88968630) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is [2-[(1E,3Z)-1-aminohexa-1,3,5-trien-2-yl]-1-methylpyrrolidin-3-yl]methanol.
| Compound Name | [2-[(1E,3Z)-1-aminohexa-1,3,5-trien-2-yl]-1-methylpyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 88968630 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | [2-[(1E,3Z)-1-aminohexa-1,3,5-trien-2-yl]-1-methylpyrrolidin-3-yl]methanol |
| SMILES | C=C/C=C\C(=C/N)C1C(CO)CCN1C |
| InChI | InChI=1S/C12H20N2O/c1-3-4-5-10(8-13)12-11(9-15)6-7-14(12)2/h3-5,8,11-12,15H,1,6-7,9,13H2,2H3/b5-4-,10-8+ |
| InChIKey | YAOCEKKCJMCCMM-BTCMVDHLSA-N |
| XLogP | 0.88 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|