C34H30F8O4S — CID 88968679
1,2,4,5-tetrafluoro-3-(2-methylbutan-2-yl)-6-[2,3,5,6-tetrafluoro-4-[4-[4-(2-methylbutan-2-yloxy)phenyl]sulfonylphenoxy]phenyl]benzene (PubChem CID 88968679) has the molecular formula C34H30F8O4S and a molecular weight of 686.66 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-(2-methylbutan-2-yl)-6-[2,3,5,6-tetrafluoro-4-[4-[4-(2-methylbutan-2-yloxy)phenyl]sulfonylphenoxy]phenyl]benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-(2-methylbutan-2-yl)-6-[2,3,5,6-tetrafluoro-4-[4-[4-(2-methylbutan-2-yloxy)phenyl]sulfonylphenoxy]phenyl]benzene |
|---|---|
| PubChem CID | 88968679 |
| Molecular Formula | C34H30F8O4S |
| Molecular Weight | 686.66 g/mol |
| Exact Mass | 686.17 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-(2-methylbutan-2-yl)-6-[2,3,5,6-tetrafluoro-4-[4-[4-(2-methylbutan-2-yloxy)phenyl]sulfonylphenoxy]phenyl]benzene |
| SMILES | CCC(C)(C)Oc1ccc(S(=O)(=O)c2ccc(Oc3c(F)c(F)c(-c4c(F)c(F)c(C(C)(C)CC)c(F)c4F)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C34H30F8O4S/c1-7-33(3,4)23-28(39)24(35)21(25(36)29(23)40)22-26(37)30(41)32(31(42)27(22)38)45-17-9-13-19(14-10-17)47(43,44)20-15-11-18(12-16-20)46-34(5,6)8-2/h9-16H,7-8H2,1-6H3 |
| InChIKey | YEWMVKYBJLCZFG-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.66 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|