About N-cyclohexa-1,5-dien-1-yl-N'-hydroxyoctanediamide
N-cyclohexa-1,5-dien-1-yl-N'-hydroxyoctanediamide (PubChem CID 88968709) has the molecular formula C14H22N2O3
and a molecular weight of 266.34 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-N'-hydroxyoctanediamide.
Molecular Properties
| Compound Name | N-cyclohexa-1,5-dien-1-yl-N'-hydroxyoctanediamide |
| PubChem CID | 88968709 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)NC1=CCCC=C1)NO |
| InChI | InChI=1S/C14H22N2O3/c17-13(15-12-8-4-3-5-9-12)10-6-1-2-7-11-14(18)16-19/h4,8-9,19H,1-3,5-7,10-11H2,(H,15,17)(H,16,18) |
| InChIKey | SWHRVJLZTFGNJU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexa-1,5-dien-1-yl-N'-hydroxyoctanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexa-1,5-dien-1-yl-N'-hydroxyoctanediamide?
The IUPAC name of N-cyclohexa-1,5-dien-1-yl-N'-hydroxyoctanediamide (CID 88968709) is N-cyclohexa-1,5-dien-1-yl-N'-hydroxyoctanediamide.
What is the SMILES notation for N-cyclohexa-1,5-dien-1-yl-N'-hydroxyoctanediamide?
The canonical SMILES for N-cyclohexa-1,5-dien-1-yl-N'-hydroxyoctanediamide is O=C(CCCCCCC(=O)NC1=CCCC=C1)NO.
What is the InChIKey of N-cyclohexa-1,5-dien-1-yl-N'-hydroxyoctanediamide?
The InChIKey is SWHRVJLZTFGNJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O3/c17-13(15-12-8-4-3-5-9-12)10-6-1-2-7-11-14(18)16-19/h4,8-9,19H,1-3,5-7,10-11H2,(H,15,17)(H,16,18).
What are the key properties of N-cyclohexa-1,5-dien-1-yl-N'-hydroxyoctanediamide?
N-cyclohexa-1,5-dien-1-yl-N'-hydroxyoctanediamide has a molecular weight of 266.34 g/mol, XLogP of 2.18, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexa-1,5-dien-1-yl-N'-hydroxyoctanediamide is sourced from PubChem (CID 88968709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).