C14H8F4O3 — CID 889695
4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzoic acid (PubChem CID 889695) has the molecular formula C14H8F4O3 and a molecular weight of 300.21 g/mol. Its IUPAC name is 4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzoic acid.
| Compound Name | 4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzoic acid |
|---|---|
| PubChem CID | 889695 |
| Molecular Formula | C14H8F4O3 |
| Molecular Weight | 300.21 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 4-[(2,3,5,6-tetrafluorophenoxy)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2c(F)c(F)cc(F)c2F)cc1 |
| InChI | InChI=1S/C14H8F4O3/c15-9-5-10(16)12(18)13(11(9)17)21-6-7-1-3-8(4-2-7)14(19)20/h1-5H,6H2,(H,19,20) |
| InChIKey | NQIUCXYOCUKXRR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.21 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|