C16H25NO2 — CID 88969774
(2E,4E,8Z)-9-(3-methyloxiran-2-yl)-N-(2-methylpropyl)nona-2,4,8-trienamide (PubChem CID 88969774) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is (2E,4E,8Z)-9-(3-methyloxiran-2-yl)-N-(2-methylpropyl)nona-2,4,8-trienamide.
| Compound Name | (2E,4E,8Z)-9-(3-methyloxiran-2-yl)-N-(2-methylpropyl)nona-2,4,8-trienamide |
|---|---|
| PubChem CID | 88969774 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | (2E,4E,8Z)-9-(3-methyloxiran-2-yl)-N-(2-methylpropyl)nona-2,4,8-trienamide |
| SMILES | CC(C)CNC(=O)/C=C/C=C/CC/C=C\C1OC1C |
| InChI | InChI=1S/C16H25NO2/c1-13(2)12-17-16(18)11-9-7-5-4-6-8-10-15-14(3)19-15/h5,7-11,13-15H,4,6,12H2,1-3H3,(H,17,18)/b7-5+,10-8-,11-9+ |
| InChIKey | WFPROLUNQSPNAR-FZRDAHGWSA-N |
| XLogP | 2.99 |
| TPSA | 41.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|