C11H19N — CID 88969833
(3E,5E)-N-butan-2-ylhepta-1,3,5-trien-2-amine (PubChem CID 88969833) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (3E,5E)-N-butan-2-ylhepta-1,3,5-trien-2-amine.
| Compound Name | (3E,5E)-N-butan-2-ylhepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 88969833 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (3E,5E)-N-butan-2-ylhepta-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C/C=C/C)NC(C)CC |
| InChI | InChI=1S/C11H19N/c1-5-7-8-9-11(4)12-10(3)6-2/h5,7-10,12H,4,6H2,1-3H3/b7-5+,9-8+ |
| InChIKey | DWMWKSUVYSQLGF-ZIRGRKGMSA-N |
| XLogP | 3.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|