C21H20O3S — CID 88970378
5-[3-[(1R,2S,3R)-3-hydroxy-5-oxo-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carbaldehyde (PubChem CID 88970378) has the molecular formula C21H20O3S and a molecular weight of 352.45 g/mol. Its IUPAC name is 5-[3-[(1R,2S,3R)-3-hydroxy-5-oxo-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carbaldehyde.
| Compound Name | 5-[3-[(1R,2S,3R)-3-hydroxy-5-oxo-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 88970378 |
| Molecular Formula | C21H20O3S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 5-[3-[(1R,2S,3R)-3-hydroxy-5-oxo-2-(2-phenylethynyl)cyclopentyl]propyl]thiophene-2-carbaldehyde |
| SMILES | O=Cc1ccc(CCC[C@H]2C(=O)C[C@@H](O)[C@@H]2C#Cc2ccccc2)s1 |
| InChI | InChI=1S/C21H20O3S/c22-14-17-11-10-16(25-17)7-4-8-18-19(21(24)13-20(18)23)12-9-15-5-2-1-3-6-15/h1-3,5-6,10-11,14,18-19,21,24H,4,7-8,13H2/t18-,19-,21-/m1/s1 |
| InChIKey | FFCWJVBEWPMZPO-SFHLNBCPSA-N |
| XLogP | 3.50 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|