C20H23N7O4S — CID 88970682
3-methyl-1-phenyl-5-[(1,1,3,5-tetraoxo-2,6-dipropyl-1,2,6-thiadiazinan-4-yl)diazenyl]pyrazole-4-carbonitrile (PubChem CID 88970682) has the molecular formula C20H23N7O4S and a molecular weight of 457.52 g/mol. Its IUPAC name is 3-methyl-1-phenyl-5-[(1,1,3,5-tetraoxo-2,6-dipropyl-1,2,6-thiadiazinan-4-yl)diazenyl]pyrazole-4-carbonitrile.
| Compound Name | 3-methyl-1-phenyl-5-[(1,1,3,5-tetraoxo-2,6-dipropyl-1,2,6-thiadiazinan-4-yl)diazenyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 88970682 |
| Molecular Formula | C20H23N7O4S |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 3-methyl-1-phenyl-5-[(1,1,3,5-tetraoxo-2,6-dipropyl-1,2,6-thiadiazinan-4-yl)diazenyl]pyrazole-4-carbonitrile |
| SMILES | CCCN1C(=O)C(/N=N/c2c(C#N)c(C)nn2-c2ccccc2)C(=O)N(CCC)S1(=O)=O |
| InChI | InChI=1S/C20H23N7O4S/c1-4-11-25-19(28)17(20(29)26(12-5-2)32(25,30)31)22-23-18-16(13-21)14(3)24-27(18)15-9-7-6-8-10-15/h6-10,17H,4-5,11-12H2,1-3H3/b23-22+ |
| InChIKey | VTIRZMXPIOOZHT-GHVJWSGMSA-N |
| XLogP | 2.24 |
| TPSA | 141.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|