C18H25FN4OSi — CID 88970818
2-[[5-[(3Z,5Z)-2-fluorohepta-1,3,5-trien-3-yl]pyrazolo[3,4-b]pyrazin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 88970818) has the molecular formula C18H25FN4OSi and a molecular weight of 360.51 g/mol. Its IUPAC name is 2-[[5-[(3Z,5Z)-2-fluorohepta-1,3,5-trien-3-yl]pyrazolo[3,4-b]pyrazin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-[(3Z,5Z)-2-fluorohepta-1,3,5-trien-3-yl]pyrazolo[3,4-b]pyrazin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 88970818 |
| Molecular Formula | C18H25FN4OSi |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 2-[[5-[(3Z,5Z)-2-fluorohepta-1,3,5-trien-3-yl]pyrazolo[3,4-b]pyrazin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C=C(F)/C(=C\C=C/C)c1cnc2c(cnn2COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C18H25FN4OSi/c1-6-7-8-15(14(2)19)16-11-20-18-17(22-16)12-21-23(18)13-24-9-10-25(3,4)5/h6-8,11-12H,2,9-10,13H2,1,3-5H3/b7-6-,15-8+ |
| InChIKey | HNIJHXLKLPWMKO-WLYYOSHGSA-N |
| XLogP | 4.58 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|