C8H12F3NO — CID 88970861
(Z)-4,4,4-trifluoro-3-methyl-N-propan-2-ylbut-2-enamide (PubChem CID 88970861) has the molecular formula C8H12F3NO and a molecular weight of 195.18 g/mol. Its IUPAC name is (Z)-4,4,4-trifluoro-3-methyl-N-propan-2-ylbut-2-enamide.
| Compound Name | (Z)-4,4,4-trifluoro-3-methyl-N-propan-2-ylbut-2-enamide |
|---|---|
| PubChem CID | 88970861 |
| Molecular Formula | C8H12F3NO |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (Z)-4,4,4-trifluoro-3-methyl-N-propan-2-ylbut-2-enamide |
| SMILES | C/C(=C/C(=O)NC(C)C)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO/c1-5(2)12-7(13)4-6(3)8(9,10)11/h4-5H,1-3H3,(H,12,13)/b6-4- |
| InChIKey | OEGBUTMZJPKZSH-XQRVVYSFSA-N |
| XLogP | 2.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|