About 2-methyl-2,3-dihydro-1H-imidazole-4-carbaldehyde
2-methyl-2,3-dihydro-1H-imidazole-4-carbaldehyde (PubChem CID 88971063) has the molecular formula C5H8N2O
and a molecular weight of 112.13 g/mol. Its IUPAC name is 2-methyl-2,3-dihydro-1H-imidazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 2-methyl-2,3-dihydro-1H-imidazole-4-carbaldehyde |
| PubChem CID | 88971063 |
| Molecular Formula | C5H8N2O |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.06 |
| IUPAC Name | 2-methyl-2,3-dihydro-1H-imidazole-4-carbaldehyde |
| SMILES | CC1NC=C(C=O)N1 |
| InChI | InChI=1S/C5H8N2O/c1-4-6-2-5(3-8)7-4/h2-4,6-7H,1H3 |
| InChIKey | AYKVBQVBUVXHBH-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-2,3-dihydro-1H-imidazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2,3-dihydro-1H-imidazole-4-carbaldehyde?
The IUPAC name of 2-methyl-2,3-dihydro-1H-imidazole-4-carbaldehyde (CID 88971063) is 2-methyl-2,3-dihydro-1H-imidazole-4-carbaldehyde.
What is the SMILES notation for 2-methyl-2,3-dihydro-1H-imidazole-4-carbaldehyde?
The canonical SMILES for 2-methyl-2,3-dihydro-1H-imidazole-4-carbaldehyde is CC1NC=C(C=O)N1.
What is the InChIKey of 2-methyl-2,3-dihydro-1H-imidazole-4-carbaldehyde?
The InChIKey is AYKVBQVBUVXHBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O/c1-4-6-2-5(3-8)7-4/h2-4,6-7H,1H3.
What are the key properties of 2-methyl-2,3-dihydro-1H-imidazole-4-carbaldehyde?
2-methyl-2,3-dihydro-1H-imidazole-4-carbaldehyde has a molecular weight of 112.13 g/mol, XLogP of -0.43, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2,3-dihydro-1H-imidazole-4-carbaldehyde is sourced from PubChem (CID 88971063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).