About 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[4-(iodoamino)cyclohexyl]urea
1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[4-(iodoamino)cyclohexyl]urea (PubChem CID 88971120) has the molecular formula C13H25IN4O3S
and a molecular weight of 444.34 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[4-(iodoamino)cyclohexyl]urea.
Molecular Properties
| Compound Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[4-(iodoamino)cyclohexyl]urea |
| PubChem CID | 88971120 |
| Molecular Formula | C13H25IN4O3S |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[4-(iodoamino)cyclohexyl]urea |
| SMILES | O=C(NCCN1CCS(=O)(=O)CC1)NC1CCC(NI)CC1 |
| InChI | InChI=1S/C13H25IN4O3S/c14-17-12-3-1-11(2-4-12)16-13(19)15-5-6-18-7-9-22(20,21)10-8-18/h11-12,17H,1-10H2,(H2,15,16,19) |
| InChIKey | JKAFBPMLKBHAAN-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[4-(iodoamino)cyclohexyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[4-(iodoamino)cyclohexyl]urea?
The IUPAC name of 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[4-(iodoamino)cyclohexyl]urea (CID 88971120) is 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[4-(iodoamino)cyclohexyl]urea.
What is the SMILES notation for 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[4-(iodoamino)cyclohexyl]urea?
The canonical SMILES for 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[4-(iodoamino)cyclohexyl]urea is O=C(NCCN1CCS(=O)(=O)CC1)NC1CCC(NI)CC1.
What is the InChIKey of 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[4-(iodoamino)cyclohexyl]urea?
The InChIKey is JKAFBPMLKBHAAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25IN4O3S/c14-17-12-3-1-11(2-4-12)16-13(19)15-5-6-18-7-9-22(20,21)10-8-18/h11-12,17H,1-10H2,(H2,15,16,19).
What are the key properties of 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[4-(iodoamino)cyclohexyl]urea?
1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[4-(iodoamino)cyclohexyl]urea has a molecular weight of 444.34 g/mol, XLogP of 0.27, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-3-[4-(iodoamino)cyclohexyl]urea is sourced from PubChem (CID 88971120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).