C22H36O6 — CID 88971709
1-[(3aS,6S,7S,7aR)-6-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-diethyl-7-hydroxy-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]-2-methylprop-2-en-1-one (PubChem CID 88971709) has the molecular formula C22H36O6 and a molecular weight of 396.52 g/mol. Its IUPAC name is 1-[(3aS,6S,7S,7aR)-6-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-diethyl-7-hydroxy-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]-2-methylprop-2-en-1-one.
| Compound Name | 1-[(3aS,6S,7S,7aR)-6-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-diethyl-7-hydroxy-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 88971709 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 1-[(3aS,6S,7S,7aR)-6-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-diethyl-7-hydroxy-3,3a,5,6,7,7a-hexahydrofuro[3,2-b]pyran-5-yl]-2-methylprop-2-en-1-one |
| SMILES | C=C(C)C(=O)C1O[C@H]2CC(CC)(CC)O[C@@H]2[C@@H](O)[C@H]1C1COC(CC)(CC)O1 |
| InChI | InChI=1S/C22H36O6/c1-7-21(8-2)11-14-19(28-21)18(24)16(20(26-14)17(23)13(5)6)15-12-25-22(9-3,10-4)27-15/h14-16,18-20,24H,5,7-12H2,1-4,6H3/t14-,15?,16+,18-,19-,20?/m0/s1 |
| InChIKey | XADKMMVEZWWPGD-FBSIEEPWSA-N |
| XLogP | 3.16 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|