C21H34O7 — CID 88971740
1-[(3aR,6R,7S,7aR)-6-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-diethyl-7-hydroxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]-2-methylprop-2-en-1-one (PubChem CID 88971740) has the molecular formula C21H34O7 and a molecular weight of 398.50 g/mol. Its IUPAC name is 1-[(3aR,6R,7S,7aR)-6-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-diethyl-7-hydroxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]-2-methylprop-2-en-1-one.
| Compound Name | 1-[(3aR,6R,7S,7aR)-6-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-diethyl-7-hydroxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]-2-methylprop-2-en-1-one |
|---|---|
| PubChem CID | 88971740 |
| Molecular Formula | C21H34O7 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | 1-[(3aR,6R,7S,7aR)-6-(2,2-diethyl-1,3-dioxolan-4-yl)-2,2-diethyl-7-hydroxy-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-yl]-2-methylprop-2-en-1-one |
| SMILES | C=C(C)C(=O)C1O[C@@H]2OC(CC)(CC)O[C@@H]2[C@@H](O)[C@@H]1C1COC(CC)(CC)O1 |
| InChI | InChI=1S/C21H34O7/c1-7-20(8-2)24-11-13(26-20)14-16(23)18-19(25-17(14)15(22)12(5)6)28-21(9-3,10-4)27-18/h13-14,16-19,23H,5,7-11H2,1-4,6H3/t13?,14-,16-,17?,18+,19+/m0/s1 |
| InChIKey | VZYFHNHKRNCULR-ZXIMJSHKSA-N |
| XLogP | 2.70 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|