C27H42O11 — CID 88971758
ethyl 2-[4-[(1S,2S)-1-[2-(2-ethoxy-2-oxoethyl)-2,4-dimethyl-1,3-dioxolan-4-yl]-1-hydroxy-5-methyl-4-oxo-3-prop-1-en-2-yloxyhex-5-en-2-yl]-2-methyl-1,3-dioxolan-2-yl]acetate (PubChem CID 88971758) has the molecular formula C27H42O11 and a molecular weight of 542.62 g/mol. Its IUPAC name is ethyl 2-[4-[(1S,2S)-1-[2-(2-ethoxy-2-oxoethyl)-2,4-dimethyl-1,3-dioxolan-4-yl]-1-hydroxy-5-methyl-4-oxo-3-prop-1-en-2-yloxyhex-5-en-2-yl]-2-methyl-1,3-dioxolan-2-yl]acetate.
| Compound Name | ethyl 2-[4-[(1S,2S)-1-[2-(2-ethoxy-2-oxoethyl)-2,4-dimethyl-1,3-dioxolan-4-yl]-1-hydroxy-5-methyl-4-oxo-3-prop-1-en-2-yloxyhex-5-en-2-yl]-2-methyl-1,3-dioxolan-2-yl]acetate |
|---|---|
| PubChem CID | 88971758 |
| Molecular Formula | C27H42O11 |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | ethyl 2-[4-[(1S,2S)-1-[2-(2-ethoxy-2-oxoethyl)-2,4-dimethyl-1,3-dioxolan-4-yl]-1-hydroxy-5-methyl-4-oxo-3-prop-1-en-2-yloxyhex-5-en-2-yl]-2-methyl-1,3-dioxolan-2-yl]acetate |
| SMILES | C=C(C)OC(C(=O)C(=C)C)[C@H](C1COC(C)(CC(=O)OCC)O1)[C@H](O)C1(C)COC(C)(CC(=O)OCC)O1 |
| InChI | InChI=1S/C27H42O11/c1-10-32-19(28)12-26(8)34-14-18(37-26)21(23(36-17(5)6)22(30)16(3)4)24(31)25(7)15-35-27(9,38-25)13-20(29)33-11-2/h18,21,23-24,31H,3,5,10-15H2,1-2,4,6-9H3/t18?,21-,23?,24-,25?,26?,27?/m0/s1 |
| InChIKey | VQPARMGHGMFTFT-NXPQZVFLSA-N |
| XLogP | 2.59 |
| TPSA | 136.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|