About (4R)-4-amino-2,10-dimethyl-6-methylideneundecan-5-one
(4R)-4-amino-2,10-dimethyl-6-methylideneundecan-5-one (PubChem CID 88972149) has the molecular formula C14H27NO
and a molecular weight of 225.38 g/mol. Its IUPAC name is (4R)-4-amino-2,10-dimethyl-6-methylideneundecan-5-one.
Molecular Properties
| Compound Name | (4R)-4-amino-2,10-dimethyl-6-methylideneundecan-5-one |
| PubChem CID | 88972149 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | (4R)-4-amino-2,10-dimethyl-6-methylideneundecan-5-one |
| SMILES | C=C(CCCC(C)C)C(=O)[C@H](N)CC(C)C |
| InChI | InChI=1S/C14H27NO/c1-10(2)7-6-8-12(5)14(16)13(15)9-11(3)4/h10-11,13H,5-9,15H2,1-4H3/t13-/m1/s1 |
| InChIKey | HYNVVPCFIMAZKR-CYBMUJFWSA-N |
| XLogP | 3.31 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-amino-2,10-dimethyl-6-methylideneundecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-amino-2,10-dimethyl-6-methylideneundecan-5-one?
The IUPAC name of (4R)-4-amino-2,10-dimethyl-6-methylideneundecan-5-one (CID 88972149) is (4R)-4-amino-2,10-dimethyl-6-methylideneundecan-5-one.
What is the SMILES notation for (4R)-4-amino-2,10-dimethyl-6-methylideneundecan-5-one?
The canonical SMILES for (4R)-4-amino-2,10-dimethyl-6-methylideneundecan-5-one is C=C(CCCC(C)C)C(=O)[C@H](N)CC(C)C.
What is the InChIKey of (4R)-4-amino-2,10-dimethyl-6-methylideneundecan-5-one?
The InChIKey is HYNVVPCFIMAZKR-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H27NO/c1-10(2)7-6-8-12(5)14(16)13(15)9-11(3)4/h10-11,13H,5-9,15H2,1-4H3/t13-/m1/s1.
What are the key properties of (4R)-4-amino-2,10-dimethyl-6-methylideneundecan-5-one?
(4R)-4-amino-2,10-dimethyl-6-methylideneundecan-5-one has a molecular weight of 225.38 g/mol, XLogP of 3.31, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-amino-2,10-dimethyl-6-methylideneundecan-5-one is sourced from PubChem (CID 88972149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).