About 6-aminoisoquinoline-1,3,4-trione
6-aminoisoquinoline-1,3,4-trione (PubChem CID 88972185) has the molecular formula C9H6N2O3
and a molecular weight of 190.16 g/mol. Its IUPAC name is 6-aminoisoquinoline-1,3,4-trione.
Molecular Properties
| Compound Name | 6-aminoisoquinoline-1,3,4-trione |
| PubChem CID | 88972185 |
| Molecular Formula | C9H6N2O3 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | 6-aminoisoquinoline-1,3,4-trione |
| SMILES | Nc1ccc2c(c1)C(=O)C(=O)NC2=O |
| InChI | InChI=1S/C9H6N2O3/c10-4-1-2-5-6(3-4)7(12)9(14)11-8(5)13/h1-3H,10H2,(H,11,13,14) |
| InChIKey | PUSCVXQTNBUYNT-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6-aminoisoquinoline-1,3,4-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-aminoisoquinoline-1,3,4-trione?
The IUPAC name of 6-aminoisoquinoline-1,3,4-trione (CID 88972185) is 6-aminoisoquinoline-1,3,4-trione.
What is the SMILES notation for 6-aminoisoquinoline-1,3,4-trione?
The canonical SMILES for 6-aminoisoquinoline-1,3,4-trione is Nc1ccc2c(c1)C(=O)C(=O)NC2=O.
What is the InChIKey of 6-aminoisoquinoline-1,3,4-trione?
The InChIKey is PUSCVXQTNBUYNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O3/c10-4-1-2-5-6(3-4)7(12)9(14)11-8(5)13/h1-3H,10H2,(H,11,13,14).
What are the key properties of 6-aminoisoquinoline-1,3,4-trione?
6-aminoisoquinoline-1,3,4-trione has a molecular weight of 190.16 g/mol, XLogP of -0.28, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-aminoisoquinoline-1,3,4-trione is sourced from PubChem (CID 88972185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).