C20H15N3O5 — CID 88972400
21-ethyl-16-methoxy-20-oxo-5,7-dioxa-11,12,21-triazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14(19),15,17-octaene-17-carbaldehyde (PubChem CID 88972400) has the molecular formula C20H15N3O5 and a molecular weight of 377.36 g/mol. Its IUPAC name is 21-ethyl-16-methoxy-20-oxo-5,7-dioxa-11,12,21-triazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14(19),15,17-octaene-17-carbaldehyde.
| Compound Name | 21-ethyl-16-methoxy-20-oxo-5,7-dioxa-11,12,21-triazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14(19),15,17-octaene-17-carbaldehyde |
|---|---|
| PubChem CID | 88972400 |
| Molecular Formula | C20H15N3O5 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 21-ethyl-16-methoxy-20-oxo-5,7-dioxa-11,12,21-triazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14(19),15,17-octaene-17-carbaldehyde |
| SMILES | CCn1c(=O)c2cc(C=O)c(OC)cc2c2nnc3cc4c(cc3c21)OCO4 |
| InChI | InChI=1S/C20H15N3O5/c1-3-23-19-13-6-16-17(28-9-27-16)7-14(13)21-22-18(19)11-5-15(26-2)10(8-24)4-12(11)20(23)25/h4-8H,3,9H2,1-2H3 |
| InChIKey | AXRBRJZRJNCYML-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|