C28H39BN4O2S — CID 88972534
CID 88972534 (PubChem CID 88972534) has the molecular formula C28H39BN4O2S and a molecular weight of 506.53 g/mol.
| Compound Name | CID 88972534 |
|---|---|
| PubChem CID | 88972534 |
| Molecular Formula | C28H39BN4O2S |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(CN2C[C@@H](N(Cc3cccc(C)c3)C(=O)CC(C)(C)C)C[C@H]2C(=O)N2CCNCC2)s1 |
| InChI | InChI=1S/C28H39BN4O2S/c1-20-6-5-7-21(14-20)17-33(26(34)16-28(2,3)4)22-15-24(27(35)31-12-10-30-11-13-31)32(18-22)19-23-8-9-25(29)36-23/h5-9,14,22,24,30H,10-13,15-19H2,1-4H3/t22-,24-/m0/s1 |
| InChIKey | NALBNAURWNOBJO-UPVQGACJSA-N |
| XLogP | 2.69 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|