About 1-fluoro-3,4-dimethylpent-4-en-2-imine
1-fluoro-3,4-dimethylpent-4-en-2-imine (PubChem CID 88972557) has the molecular formula C7H12FN
and a molecular weight of 129.18 g/mol. Its IUPAC name is 1-fluoro-3,4-dimethylpent-4-en-2-imine.
Molecular Properties
| Compound Name | 1-fluoro-3,4-dimethylpent-4-en-2-imine |
| PubChem CID | 88972557 |
| Molecular Formula | C7H12FN |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | 1-fluoro-3,4-dimethylpent-4-en-2-imine |
| SMILES | [H]/N=C(\CF)C(C)C(=C)C |
| InChI | InChI=1S/C7H12FN/c1-5(2)6(3)7(9)4-8/h6,9H,1,4H2,2-3H3/b9-7+ |
| InChIKey | CITWRUSFXLYSMT-VQHVLOKHSA-N |
| XLogP | 2.19 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-fluoro-3,4-dimethylpent-4-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-3,4-dimethylpent-4-en-2-imine?
The IUPAC name of 1-fluoro-3,4-dimethylpent-4-en-2-imine (CID 88972557) is 1-fluoro-3,4-dimethylpent-4-en-2-imine.
What is the SMILES notation for 1-fluoro-3,4-dimethylpent-4-en-2-imine?
The canonical SMILES for 1-fluoro-3,4-dimethylpent-4-en-2-imine is [H]/N=C(\CF)C(C)C(=C)C.
What is the InChIKey of 1-fluoro-3,4-dimethylpent-4-en-2-imine?
The InChIKey is CITWRUSFXLYSMT-VQHVLOKHSA-N. The full InChI is InChI=1S/C7H12FN/c1-5(2)6(3)7(9)4-8/h6,9H,1,4H2,2-3H3/b9-7+.
What are the key properties of 1-fluoro-3,4-dimethylpent-4-en-2-imine?
1-fluoro-3,4-dimethylpent-4-en-2-imine has a molecular weight of 129.18 g/mol, XLogP of 2.19, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-3,4-dimethylpent-4-en-2-imine is sourced from PubChem (CID 88972557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).