C24H32Br2N2O2 — CID 88972697
11,15-dibromo-5-tert-butyl-16-methoxy-8,8-dimethyl-4-oxa-1,5-diazatetracyclo[10.8.0.02,10.013,18]icosa-2(10),11,13,15,17-pentaene (PubChem CID 88972697) has the molecular formula C24H32Br2N2O2 and a molecular weight of 540.34 g/mol. Its IUPAC name is 11,15-dibromo-5-tert-butyl-16-methoxy-8,8-dimethyl-4-oxa-1,5-diazatetracyclo[10.8.0.02,10.013,18]icosa-2(10),11,13,15,17-pentaene.
| Compound Name | 11,15-dibromo-5-tert-butyl-16-methoxy-8,8-dimethyl-4-oxa-1,5-diazatetracyclo[10.8.0.02,10.013,18]icosa-2(10),11,13,15,17-pentaene |
|---|---|
| PubChem CID | 88972697 |
| Molecular Formula | C24H32Br2N2O2 |
| Molecular Weight | 540.34 g/mol |
| Exact Mass | 538.08 |
| IUPAC Name | 11,15-dibromo-5-tert-butyl-16-methoxy-8,8-dimethyl-4-oxa-1,5-diazatetracyclo[10.8.0.02,10.013,18]icosa-2(10),11,13,15,17-pentaene |
| SMILES | COc1cc2c(cc1Br)-c1c(Br)c3c(n1CC2)CON(C(C)(C)C)CCC(C)(C)C3 |
| InChI | InChI=1S/C24H32Br2N2O2/c1-23(2,3)28-10-8-24(4,5)13-17-19(14-30-28)27-9-7-15-11-20(29-6)18(25)12-16(15)22(27)21(17)26/h11-12H,7-10,13-14H2,1-6H3 |
| InChIKey | PZZYTBGZMNKMSN-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.34 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |