C17H17ClN4O — CID 88972896
1-[3-(1-chloro-4,5-dihydroimidazol-2-yl)phenyl]-3-(3-methylphenyl)urea (PubChem CID 88972896) has the molecular formula C17H17ClN4O and a molecular weight of 328.80 g/mol. Its IUPAC name is 1-[3-(1-chloro-4,5-dihydroimidazol-2-yl)phenyl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[3-(1-chloro-4,5-dihydroimidazol-2-yl)phenyl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 88972896 |
| Molecular Formula | C17H17ClN4O |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 1-[3-(1-chloro-4,5-dihydroimidazol-2-yl)phenyl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2cccc(C3=NCCN3Cl)c2)c1 |
| InChI | InChI=1S/C17H17ClN4O/c1-12-4-2-6-14(10-12)20-17(23)21-15-7-3-5-13(11-15)16-19-8-9-22(16)18/h2-7,10-11H,8-9H2,1H3,(H2,20,21,23) |
| InChIKey | LEAWKRQFGZMFRV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|