C19H28O2 — CID 88973146
(2E,4E)-5-[(4aR,7S)-7-hydroxy-2,6,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-2-methylpenta-2,4-dienal (PubChem CID 88973146) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (2E,4E)-5-[(4aR,7S)-7-hydroxy-2,6,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-2-methylpenta-2,4-dienal.
| Compound Name | (2E,4E)-5-[(4aR,7S)-7-hydroxy-2,6,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-2-methylpenta-2,4-dienal |
|---|---|
| PubChem CID | 88973146 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (2E,4E)-5-[(4aR,7S)-7-hydroxy-2,6,8-trimethyl-1,2,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-2-methylpenta-2,4-dienal |
| SMILES | C/C(C=O)=C\C=C\C1C(C)C=C[C@H]2CC(C)[C@H](O)C(C)C12 |
| InChI | InChI=1S/C19H28O2/c1-12(11-20)6-5-7-17-13(2)8-9-16-10-14(3)19(21)15(4)18(16)17/h5-9,11,13-19,21H,10H2,1-4H3/b7-5+,12-6+/t13?,14?,15?,16-,17?,18?,19-/m0/s1 |
| InChIKey | YXESZOOREAMVRR-GMIBAGELSA-N |
| XLogP | 3.78 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|