C15H23BFN5O — CID 88973222
CID 88973222 (PubChem CID 88973222) has the molecular formula C15H23BFN5O and a molecular weight of 319.19 g/mol.
| Compound Name | CID 88973222 |
|---|---|
| PubChem CID | 88973222 |
| Molecular Formula | C15H23BFN5O |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | — |
| SMILES | [B]N(CC(=O)N1C[C@@H](F)C[C@H]1C)[C@@H]1CC[C@H](Cn2cncn2)C1 |
| InChI | InChI=1S/C15H23BFN5O/c1-11-4-13(17)7-21(11)15(23)8-22(16)14-3-2-12(5-14)6-20-10-18-9-19-20/h9-14H,2-8H2,1H3/t11-,12+,13+,14-/m1/s1 |
| InChIKey | XUBZOQISOREFLG-ZOBORPQBSA-N |
| XLogP | 0.79 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|