About 4-(4-aminophenoxy)-3-(1,3-diazinan-2-yl)pyridin-2-amine
4-(4-aminophenoxy)-3-(1,3-diazinan-2-yl)pyridin-2-amine (PubChem CID 88973251) has the molecular formula C15H19N5O
and a molecular weight of 285.35 g/mol. Its IUPAC name is 4-(4-aminophenoxy)-3-(1,3-diazinan-2-yl)pyridin-2-amine.
Molecular Properties
| Compound Name | 4-(4-aminophenoxy)-3-(1,3-diazinan-2-yl)pyridin-2-amine |
| PubChem CID | 88973251 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 4-(4-aminophenoxy)-3-(1,3-diazinan-2-yl)pyridin-2-amine |
| SMILES | Nc1ccc(Oc2ccnc(N)c2C2NCCCN2)cc1 |
| InChI | InChI=1S/C15H19N5O/c16-10-2-4-11(5-3-10)21-12-6-9-18-14(17)13(12)15-19-7-1-8-20-15/h2-6,9,15,19-20H,1,7-8,16H2,(H2,17,18) |
| InChIKey | PLAZAUQPDDOXQK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-aminophenoxy)-3-(1,3-diazinan-2-yl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-aminophenoxy)-3-(1,3-diazinan-2-yl)pyridin-2-amine?
The IUPAC name of 4-(4-aminophenoxy)-3-(1,3-diazinan-2-yl)pyridin-2-amine (CID 88973251) is 4-(4-aminophenoxy)-3-(1,3-diazinan-2-yl)pyridin-2-amine.
What is the SMILES notation for 4-(4-aminophenoxy)-3-(1,3-diazinan-2-yl)pyridin-2-amine?
The canonical SMILES for 4-(4-aminophenoxy)-3-(1,3-diazinan-2-yl)pyridin-2-amine is Nc1ccc(Oc2ccnc(N)c2C2NCCCN2)cc1.
What is the InChIKey of 4-(4-aminophenoxy)-3-(1,3-diazinan-2-yl)pyridin-2-amine?
The InChIKey is PLAZAUQPDDOXQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N5O/c16-10-2-4-11(5-3-10)21-12-6-9-18-14(17)13(12)15-19-7-1-8-20-15/h2-6,9,15,19-20H,1,7-8,16H2,(H2,17,18).
What are the key properties of 4-(4-aminophenoxy)-3-(1,3-diazinan-2-yl)pyridin-2-amine?
4-(4-aminophenoxy)-3-(1,3-diazinan-2-yl)pyridin-2-amine has a molecular weight of 285.35 g/mol, XLogP of 1.62, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-aminophenoxy)-3-(1,3-diazinan-2-yl)pyridin-2-amine is sourced from PubChem (CID 88973251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).