C16H16F6N2O4 — CID 88973357
(2R,4R)-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]-5-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]pentanoic acid (PubChem CID 88973357) has the molecular formula C16H16F6N2O4 and a molecular weight of 414.30 g/mol. Its IUPAC name is (2R,4R)-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]-5-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]pentanoic acid.
| Compound Name | (2R,4R)-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]-5-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 88973357 |
| Molecular Formula | C16H16F6N2O4 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | (2R,4R)-2-methyl-4-[(2,2,2-trifluoroacetyl)amino]-5-[4-[(2,2,2-trifluoroacetyl)amino]phenyl]pentanoic acid |
| SMILES | C[C@H](C[C@H](Cc1ccc(NC(=O)C(F)(F)F)cc1)NC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C16H16F6N2O4/c1-8(12(25)26)6-11(24-14(28)16(20,21)22)7-9-2-4-10(5-3-9)23-13(27)15(17,18)19/h2-5,8,11H,6-7H2,1H3,(H,23,27)(H,24,28)(H,25,26)/t8-,11-/m1/s1 |
| InChIKey | IGHKIWGANMMOEF-LDYMZIIASA-N |
| XLogP | 2.89 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |