C19H26N4O5S — CID 88973538
6-butoxy-1-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]-5-oxoimidazo[1,2-a]pyrimidine-7-carbothioic S-acid (PubChem CID 88973538) has the molecular formula C19H26N4O5S and a molecular weight of 422.51 g/mol. Its IUPAC name is 6-butoxy-1-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]-5-oxoimidazo[1,2-a]pyrimidine-7-carbothioic S-acid.
| Compound Name | 6-butoxy-1-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]-5-oxoimidazo[1,2-a]pyrimidine-7-carbothioic S-acid |
|---|---|
| PubChem CID | 88973538 |
| Molecular Formula | C19H26N4O5S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 6-butoxy-1-[2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-2-oxoethyl]-5-oxoimidazo[1,2-a]pyrimidine-7-carbothioic S-acid |
| SMILES | CCCCOc1c(C(=O)S)nc2n(CC(=O)N3C[C@H](C)O[C@@H](C)C3)ccn2c1=O |
| InChI | InChI=1S/C19H26N4O5S/c1-4-5-8-27-16-15(18(26)29)20-19-21(6-7-23(19)17(16)25)11-14(24)22-9-12(2)28-13(3)10-22/h6-7,12-13H,4-5,8-11H2,1-3H3,(H,26,29)/t12-,13-/m0/s1 |
| InChIKey | LFGJHUDCZNQPAB-STQMWFEESA-N |
| XLogP | 1.38 |
| TPSA | 95.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|