About N-tert-butyl-2-[(E)-4,4-difluoro-5-methylhex-2-enoxy]-2-methylpropan-1-amine
N-tert-butyl-2-[(E)-4,4-difluoro-5-methylhex-2-enoxy]-2-methylpropan-1-amine (PubChem CID 88973540) has the molecular formula C15H29F2NO
and a molecular weight of 277.40 g/mol. Its IUPAC name is N-tert-butyl-2-[(E)-4,4-difluoro-5-methylhex-2-enoxy]-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-2-[(E)-4,4-difluoro-5-methylhex-2-enoxy]-2-methylpropan-1-amine |
| PubChem CID | 88973540 |
| Molecular Formula | C15H29F2NO |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | N-tert-butyl-2-[(E)-4,4-difluoro-5-methylhex-2-enoxy]-2-methylpropan-1-amine |
| SMILES | CC(C)C(F)(F)/C=C/COC(C)(C)CNC(C)(C)C |
| InChI | InChI=1S/C15H29F2NO/c1-12(2)15(16,17)9-8-10-19-14(6,7)11-18-13(3,4)5/h8-9,12,18H,10-11H2,1-7H3/b9-8+ |
| InChIKey | ZVZCGOPLSJUTOD-CMDGGOBGSA-N |
| XLogP | 4.02 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-2-[(E)-4,4-difluoro-5-methylhex-2-enoxy]-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-[(E)-4,4-difluoro-5-methylhex-2-enoxy]-2-methylpropan-1-amine?
The IUPAC name of N-tert-butyl-2-[(E)-4,4-difluoro-5-methylhex-2-enoxy]-2-methylpropan-1-amine (CID 88973540) is N-tert-butyl-2-[(E)-4,4-difluoro-5-methylhex-2-enoxy]-2-methylpropan-1-amine.
What is the SMILES notation for N-tert-butyl-2-[(E)-4,4-difluoro-5-methylhex-2-enoxy]-2-methylpropan-1-amine?
The canonical SMILES for N-tert-butyl-2-[(E)-4,4-difluoro-5-methylhex-2-enoxy]-2-methylpropan-1-amine is CC(C)C(F)(F)/C=C/COC(C)(C)CNC(C)(C)C.
What is the InChIKey of N-tert-butyl-2-[(E)-4,4-difluoro-5-methylhex-2-enoxy]-2-methylpropan-1-amine?
The InChIKey is ZVZCGOPLSJUTOD-CMDGGOBGSA-N. The full InChI is InChI=1S/C15H29F2NO/c1-12(2)15(16,17)9-8-10-19-14(6,7)11-18-13(3,4)5/h8-9,12,18H,10-11H2,1-7H3/b9-8+.
What are the key properties of N-tert-butyl-2-[(E)-4,4-difluoro-5-methylhex-2-enoxy]-2-methylpropan-1-amine?
N-tert-butyl-2-[(E)-4,4-difluoro-5-methylhex-2-enoxy]-2-methylpropan-1-amine has a molecular weight of 277.40 g/mol, XLogP of 4.02, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-[(E)-4,4-difluoro-5-methylhex-2-enoxy]-2-methylpropan-1-amine is sourced from PubChem (CID 88973540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).