C16H33F2N — CID 88973658
N-tert-butyl-7,7-difluoro-2,2,8-trimethylnonan-1-amine (PubChem CID 88973658) has the molecular formula C16H33F2N and a molecular weight of 277.44 g/mol. Its IUPAC name is N-tert-butyl-7,7-difluoro-2,2,8-trimethylnonan-1-amine.
| Compound Name | N-tert-butyl-7,7-difluoro-2,2,8-trimethylnonan-1-amine |
|---|---|
| PubChem CID | 88973658 |
| Molecular Formula | C16H33F2N |
| Molecular Weight | 277.44 g/mol |
| Exact Mass | 277.26 |
| IUPAC Name | N-tert-butyl-7,7-difluoro-2,2,8-trimethylnonan-1-amine |
| SMILES | CC(C)C(F)(F)CCCCC(C)(C)CNC(C)(C)C |
| InChI | InChI=1S/C16H33F2N/c1-13(2)16(17,18)11-9-8-10-15(6,7)12-19-14(3,4)5/h13,19H,8-12H2,1-7H3 |
| InChIKey | ONPGIAVCVTWYFH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|