C20H30S3 — CID 88973790
(3Z,5E)-5-[(3Z)-5-hex-1-en-2-ylsulfanylhepta-1,3-dien-2-yl]sulfanylhepta-1,3,5-triene-2-thiol (PubChem CID 88973790) has the molecular formula C20H30S3 and a molecular weight of 366.66 g/mol. Its IUPAC name is (3Z,5E)-5-[(3Z)-5-hex-1-en-2-ylsulfanylhepta-1,3-dien-2-yl]sulfanylhepta-1,3,5-triene-2-thiol.
| Compound Name | (3Z,5E)-5-[(3Z)-5-hex-1-en-2-ylsulfanylhepta-1,3-dien-2-yl]sulfanylhepta-1,3,5-triene-2-thiol |
|---|---|
| PubChem CID | 88973790 |
| Molecular Formula | C20H30S3 |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | (3Z,5E)-5-[(3Z)-5-hex-1-en-2-ylsulfanylhepta-1,3-dien-2-yl]sulfanylhepta-1,3,5-triene-2-thiol |
| SMILES | C=C(S)/C=C\C(=C/C)SC(=C)/C=C\C(CC)SC(=C)CCCC |
| InChI | InChI=1S/C20H30S3/c1-7-10-11-17(5)22-20(9-3)15-13-18(6)23-19(8-2)14-12-16(4)21/h8,12-15,20-21H,4-7,9-11H2,1-3H3/b14-12-,15-13-,19-8+ |
| InChIKey | ZJWLQDVCBPVWTF-BACZMXRUSA-N |
| XLogP | 7.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|