C30H48O3S3 — CID 88973791
5-methoxy-3-[(Z)-6-[(3E,5Z)-2-methoxy-7-[(Z)-7-methoxyhept-5-en-3-yl]sulfanylhepta-1,3,5-trien-4-yl]sulfanylhept-4-en-3-yl]sulfanylcyclohexene (PubChem CID 88973791) has the molecular formula C30H48O3S3 and a molecular weight of 552.91 g/mol. Its IUPAC name is 5-methoxy-3-[(Z)-6-[(3E,5Z)-2-methoxy-7-[(Z)-7-methoxyhept-5-en-3-yl]sulfanylhepta-1,3,5-trien-4-yl]sulfanylhept-4-en-3-yl]sulfanylcyclohexene.
| Compound Name | 5-methoxy-3-[(Z)-6-[(3E,5Z)-2-methoxy-7-[(Z)-7-methoxyhept-5-en-3-yl]sulfanylhepta-1,3,5-trien-4-yl]sulfanylhept-4-en-3-yl]sulfanylcyclohexene |
|---|---|
| PubChem CID | 88973791 |
| Molecular Formula | C30H48O3S3 |
| Molecular Weight | 552.91 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | 5-methoxy-3-[(Z)-6-[(3E,5Z)-2-methoxy-7-[(Z)-7-methoxyhept-5-en-3-yl]sulfanylhepta-1,3,5-trien-4-yl]sulfanylhept-4-en-3-yl]sulfanylcyclohexene |
| SMILES | C=C(/C=C(\C=C/CSC(CC)C/C=C\COC)SC(C)/C=C\C(CC)SC1C=CCC(OC)C1)OC |
| InChI | InChI=1S/C30H48O3S3/c1-8-27(15-10-11-20-31-5)34-21-13-17-29(22-24(3)32-6)35-25(4)18-19-28(9-2)36-30-16-12-14-26(23-30)33-7/h10-13,16-19,22,25-28,30H,3,8-9,14-15,20-21,23H2,1-2,4-7H3/b11-10-,17-13-,19-18-,29-22+ |
| InChIKey | DWTAYOMRGKMTBF-PMFSSERCSA-N |
| XLogP | 8.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.91 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|