About 2-chloro-4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole
2-chloro-4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole (PubChem CID 88973812) has the molecular formula C7H8ClNS
and a molecular weight of 173.67 g/mol. Its IUPAC name is 2-chloro-4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole.
Molecular Properties
| Compound Name | 2-chloro-4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole |
| PubChem CID | 88973812 |
| Molecular Formula | C7H8ClNS |
| Molecular Weight | 173.67 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | 2-chloro-4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole |
| SMILES | CC1CCc2sc(Cl)nc21 |
| InChI | InChI=1S/C7H8ClNS/c1-4-2-3-5-6(4)9-7(8)10-5/h4H,2-3H2,1H3 |
| InChIKey | ATTXOPBXCCFGOS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.67 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole?
The IUPAC name of 2-chloro-4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole (CID 88973812) is 2-chloro-4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole.
What is the SMILES notation for 2-chloro-4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole?
The canonical SMILES for 2-chloro-4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole is CC1CCc2sc(Cl)nc21.
What is the InChIKey of 2-chloro-4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole?
The InChIKey is ATTXOPBXCCFGOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClNS/c1-4-2-3-5-6(4)9-7(8)10-5/h4H,2-3H2,1H3.
What are the key properties of 2-chloro-4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole?
2-chloro-4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole has a molecular weight of 173.67 g/mol, XLogP of 2.85, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazole is sourced from PubChem (CID 88973812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).