About (4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)methanol
(4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)methanol (PubChem CID 88973814) has the molecular formula C8H11NOS
and a molecular weight of 169.25 g/mol. Its IUPAC name is (4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)methanol.
Molecular Properties
| Compound Name | (4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)methanol |
| PubChem CID | 88973814 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | (4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)methanol |
| SMILES | CC1CCc2sc(CO)nc21 |
| InChI | InChI=1S/C8H11NOS/c1-5-2-3-6-8(5)9-7(4-10)11-6/h5,10H,2-4H2,1H3 |
| InChIKey | NUQIJUSNFCIHBY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)methanol?
The IUPAC name of (4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)methanol (CID 88973814) is (4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)methanol.
What is the SMILES notation for (4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)methanol?
The canonical SMILES for (4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)methanol is CC1CCc2sc(CO)nc21.
What is the InChIKey of (4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)methanol?
The InChIKey is NUQIJUSNFCIHBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NOS/c1-5-2-3-6-8(5)9-7(4-10)11-6/h5,10H,2-4H2,1H3.
What are the key properties of (4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)methanol?
(4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)methanol has a molecular weight of 169.25 g/mol, XLogP of 1.69, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-5,6-dihydro-4H-cyclopenta[d][1,3]thiazol-2-yl)methanol is sourced from PubChem (CID 88973814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).