About 4-O-(11-amino-2-octyl-11-oxoundecyl) 1-O-(oxiran-2-ylmethyl) butanedioate
4-O-(11-amino-2-octyl-11-oxoundecyl) 1-O-(oxiran-2-ylmethyl) butanedioate (PubChem CID 88974314) has the molecular formula C26H47NO6
and a molecular weight of 469.66 g/mol. Its IUPAC name is 4-O-(11-amino-2-octyl-11-oxoundecyl) 1-O-(oxiran-2-ylmethyl) butanedioate.
Molecular Properties
| Compound Name | 4-O-(11-amino-2-octyl-11-oxoundecyl) 1-O-(oxiran-2-ylmethyl) butanedioate |
| PubChem CID | 88974314 |
| Molecular Formula | C26H47NO6 |
| Molecular Weight | 469.66 g/mol |
| Exact Mass | 469.34 |
| IUPAC Name | 4-O-(11-amino-2-octyl-11-oxoundecyl) 1-O-(oxiran-2-ylmethyl) butanedioate |
| SMILES | CCCCCCCCC(CCCCCCCCC(N)=O)COC(=O)CCC(=O)OCC1CO1 |
| InChI | InChI=1S/C26H47NO6/c1-2-3-4-5-8-11-14-22(15-12-9-6-7-10-13-16-24(27)28)19-32-25(29)17-18-26(30)33-21-23-20-31-23/h22-23H,2-21H2,1H3,(H2,27,28) |
| InChIKey | WKTNSYBEWJXTHR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 108.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.66 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-O-(11-amino-2-octyl-11-oxoundecyl) 1-O-(oxiran-2-ylmethyl) butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(11-amino-2-octyl-11-oxoundecyl) 1-O-(oxiran-2-ylmethyl) butanedioate?
The IUPAC name of 4-O-(11-amino-2-octyl-11-oxoundecyl) 1-O-(oxiran-2-ylmethyl) butanedioate (CID 88974314) is 4-O-(11-amino-2-octyl-11-oxoundecyl) 1-O-(oxiran-2-ylmethyl) butanedioate.
What is the SMILES notation for 4-O-(11-amino-2-octyl-11-oxoundecyl) 1-O-(oxiran-2-ylmethyl) butanedioate?
The canonical SMILES for 4-O-(11-amino-2-octyl-11-oxoundecyl) 1-O-(oxiran-2-ylmethyl) butanedioate is CCCCCCCCC(CCCCCCCCC(N)=O)COC(=O)CCC(=O)OCC1CO1.
What is the InChIKey of 4-O-(11-amino-2-octyl-11-oxoundecyl) 1-O-(oxiran-2-ylmethyl) butanedioate?
The InChIKey is WKTNSYBEWJXTHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H47NO6/c1-2-3-4-5-8-11-14-22(15-12-9-6-7-10-13-16-24(27)28)19-32-25(29)17-18-26(30)33-21-23-20-31-23/h22-23H,2-21H2,1H3,(H2,27,28).
What are the key properties of 4-O-(11-amino-2-octyl-11-oxoundecyl) 1-O-(oxiran-2-ylmethyl) butanedioate?
4-O-(11-amino-2-octyl-11-oxoundecyl) 1-O-(oxiran-2-ylmethyl) butanedioate has a molecular weight of 469.66 g/mol, XLogP of 5.22, 23 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(11-amino-2-octyl-11-oxoundecyl) 1-O-(oxiran-2-ylmethyl) butanedioate is sourced from PubChem (CID 88974314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).