About (2Z)-2-(2,3-dihydro-1H-pyrrol-5-ylmethylidene)pyrrole
(2Z)-2-(2,3-dihydro-1H-pyrrol-5-ylmethylidene)pyrrole (PubChem CID 88974484) has the molecular formula C9H10N2
and a molecular weight of 146.19 g/mol. Its IUPAC name is (2Z)-2-(2,3-dihydro-1H-pyrrol-5-ylmethylidene)pyrrole.
Molecular Properties
| Compound Name | (2Z)-2-(2,3-dihydro-1H-pyrrol-5-ylmethylidene)pyrrole |
| PubChem CID | 88974484 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | (2Z)-2-(2,3-dihydro-1H-pyrrol-5-ylmethylidene)pyrrole |
| SMILES | C1=C/C(=C/C2=CCCN2)N=C1 |
| InChI | InChI=1S/C9H10N2/c1-3-8(10-5-1)7-9-4-2-6-11-9/h1,3-5,7,11H,2,6H2/b8-7- |
| InChIKey | SYPWOGJBGCSOLC-FPLPWBNLSA-N |
| XLogP | 1.39 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2Z)-2-(2,3-dihydro-1H-pyrrol-5-ylmethylidene)pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(2,3-dihydro-1H-pyrrol-5-ylmethylidene)pyrrole?
The IUPAC name of (2Z)-2-(2,3-dihydro-1H-pyrrol-5-ylmethylidene)pyrrole (CID 88974484) is (2Z)-2-(2,3-dihydro-1H-pyrrol-5-ylmethylidene)pyrrole.
What is the SMILES notation for (2Z)-2-(2,3-dihydro-1H-pyrrol-5-ylmethylidene)pyrrole?
The canonical SMILES for (2Z)-2-(2,3-dihydro-1H-pyrrol-5-ylmethylidene)pyrrole is C1=C/C(=C/C2=CCCN2)N=C1.
What is the InChIKey of (2Z)-2-(2,3-dihydro-1H-pyrrol-5-ylmethylidene)pyrrole?
The InChIKey is SYPWOGJBGCSOLC-FPLPWBNLSA-N. The full InChI is InChI=1S/C9H10N2/c1-3-8(10-5-1)7-9-4-2-6-11-9/h1,3-5,7,11H,2,6H2/b8-7-.
What are the key properties of (2Z)-2-(2,3-dihydro-1H-pyrrol-5-ylmethylidene)pyrrole?
(2Z)-2-(2,3-dihydro-1H-pyrrol-5-ylmethylidene)pyrrole has a molecular weight of 146.19 g/mol, XLogP of 1.39, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(2,3-dihydro-1H-pyrrol-5-ylmethylidene)pyrrole is sourced from PubChem (CID 88974484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).