C36H62O7S2 — CID 88974631
(2R,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-[2-(4-butoxyphenyl)-1,3-dithian-2-yl]oxan-2-ol (PubChem CID 88974631) has the molecular formula C36H62O7S2 and a molecular weight of 671.02 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-[2-(4-butoxyphenyl)-1,3-dithian-2-yl]oxan-2-ol.
| Compound Name | (2R,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-[2-(4-butoxyphenyl)-1,3-dithian-2-yl]oxan-2-ol |
|---|---|
| PubChem CID | 88974631 |
| Molecular Formula | C36H62O7S2 |
| Molecular Weight | 671.02 g/mol |
| Exact Mass | 670.39 |
| IUPAC Name | (2R,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-[2-(4-butoxyphenyl)-1,3-dithian-2-yl]oxan-2-ol |
| SMILES | CCCCOC[C@H]1O[C@@](O)(C2(c3ccc(OCCCC)cc3)SCCCS2)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C36H62O7S2/c1-6-11-21-38-28-31-32(40-23-13-8-3)33(41-24-14-9-4)34(42-25-15-10-5)35(37,43-31)36(44-26-16-27-45-36)29-17-19-30(20-18-29)39-22-12-7-2/h17-20,31-34,37H,6-16,21-28H2,1-5H3/t31-,32-,33+,34-,35-/m1/s1 |
| InChIKey | WDUNVZNOMJJSII-CKQPALCZSA-N |
| XLogP | 8.35 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.02 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|