C32H54O6S2 — CID 88974648
(2R,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-(2-phenyl-1,3-dithian-2-yl)oxan-2-ol (PubChem CID 88974648) has the molecular formula C32H54O6S2 and a molecular weight of 598.91 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-(2-phenyl-1,3-dithian-2-yl)oxan-2-ol.
| Compound Name | (2R,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-(2-phenyl-1,3-dithian-2-yl)oxan-2-ol |
|---|---|
| PubChem CID | 88974648 |
| Molecular Formula | C32H54O6S2 |
| Molecular Weight | 598.91 g/mol |
| Exact Mass | 598.34 |
| IUPAC Name | (2R,3R,4S,5R,6R)-3,4,5-tributoxy-6-(butoxymethyl)-2-(2-phenyl-1,3-dithian-2-yl)oxan-2-ol |
| SMILES | CCCCOC[C@H]1O[C@@](O)(C2(c3ccccc3)SCCCS2)[C@H](OCCCC)[C@@H](OCCCC)[C@@H]1OCCCC |
| InChI | InChI=1S/C32H54O6S2/c1-5-9-19-34-25-27-28(35-20-10-6-2)29(36-21-11-7-3)30(37-22-12-8-4)31(33,38-27)32(39-23-16-24-40-32)26-17-14-13-15-18-26/h13-15,17-18,27-30,33H,5-12,16,19-25H2,1-4H3/t27-,28-,29+,30-,31-/m1/s1 |
| InChIKey | CEVKQYJSYHPKDH-PXPWAULYSA-N |
| XLogP | 7.17 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.91 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|